About 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole
3,5-ditert-butyl-5-methyl-4H-1,2-oxazole (PubChem CID 58735361) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole |
| PubChem CID | 58735361 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole |
| SMILES | CC(C)(C)C1=NOC(C)(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H23NO/c1-10(2,3)9-8-12(7,14-13-9)11(4,5)6/h8H2,1-7H3 |
| InChIKey | LZHLCQVZJKMPLC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole?
The IUPAC name of 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole (CID 58735361) is 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole.
What is the SMILES notation for 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole?
The canonical SMILES for 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole is CC(C)(C)C1=NOC(C)(C(C)(C)C)C1.
What is the InChIKey of 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole?
The InChIKey is LZHLCQVZJKMPLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-10(2,3)9-8-12(7,14-13-9)11(4,5)6/h8H2,1-7H3.
What are the key properties of 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole?
3,5-ditert-butyl-5-methyl-4H-1,2-oxazole has a molecular weight of 197.32 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-5-methyl-4H-1,2-oxazole is sourced from PubChem (CID 58735361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).