C12H23NO — CID 58735461
2,2,3,3-tetramethyl-1-pyrrolidin-1-ylbutan-1-one (PubChem CID 58735461) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-1-pyrrolidin-1-ylbutan-1-one.
| Compound Name | 2,2,3,3-tetramethyl-1-pyrrolidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 58735461 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2,2,3,3-tetramethyl-1-pyrrolidin-1-ylbutan-1-one |
| SMILES | CC(C)(C)C(C)(C)C(=O)N1CCCC1 |
| InChI | InChI=1S/C12H23NO/c1-11(2,3)12(4,5)10(14)13-8-6-7-9-13/h6-9H2,1-5H3 |
| InChIKey | LAMQLHLDSRRJQD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |