C12H9BrF3NO4 — CID 58736056
3-[[(1S)-1-(4-bromofuran-2-yl)-2,2,2-trifluoroethyl]amino]-4-ethoxycyclobut-3-ene-1,2-dione (PubChem CID 58736056) has the molecular formula C12H9BrF3NO4 and a molecular weight of 368.11 g/mol. Its IUPAC name is 3-[[(1S)-1-(4-bromofuran-2-yl)-2,2,2-trifluoroethyl]amino]-4-ethoxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1S)-1-(4-bromofuran-2-yl)-2,2,2-trifluoroethyl]amino]-4-ethoxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 58736056 |
| Molecular Formula | C12H9BrF3NO4 |
| Molecular Weight | 368.11 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 3-[[(1S)-1-(4-bromofuran-2-yl)-2,2,2-trifluoroethyl]amino]-4-ethoxycyclobut-3-ene-1,2-dione |
| SMILES | CCOc1c(N[C@@H](c2cc(Br)co2)C(F)(F)F)c(=O)c1=O |
| InChI | InChI=1S/C12H9BrF3NO4/c1-2-20-10-7(8(18)9(10)19)17-11(12(14,15)16)6-3-5(13)4-21-6/h3-4,11,17H,2H2,1H3/t11-/m0/s1 |
| InChIKey | KDPAJOZJOLEGOT-NSHDSACASA-N |
| XLogP | 2.75 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.11 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|