C21H22N4O5 — CID 58736389
3-[[2-[[(R)-cyclopropyl-(3-methyl-1,2-oxazol-5-yl)methyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 58736389) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 3-[[2-[[(R)-cyclopropyl-(3-methyl-1,2-oxazol-5-yl)methyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[[(R)-cyclopropyl-(3-methyl-1,2-oxazol-5-yl)methyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 58736389 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-[[2-[[(R)-cyclopropyl-(3-methyl-1,2-oxazol-5-yl)methyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | Cc1cc([C@H](Nc2c(Nc3cccc(C(=O)N(C)C)c3O)c(=O)c2=O)C2CC2)on1 |
| InChI | InChI=1S/C21H22N4O5/c1-10-9-14(30-24-10)15(11-7-8-11)23-17-16(19(27)20(17)28)22-13-6-4-5-12(18(13)26)21(29)25(2)3/h4-6,9,11,15,22-23,26H,7-8H2,1-3H3/t15-/m1/s1 |
| InChIKey | CEMMQYZEISREMK-OAHLLOKOSA-N |
| XLogP | 2.29 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|