About 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one
8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 58736676) has the molecular formula C9H8N2O4
and a molecular weight of 208.17 g/mol. Its IUPAC name is 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 58736676 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCc2ccc([N+](=O)[O-])c(O)c21 |
| InChI | InChI=1S/C9H8N2O4/c12-8-6(11(14)15)2-1-5-3-4-10-9(13)7(5)8/h1-2,12H,3-4H2,(H,10,13) |
| InChIKey | VUHJZOZDPJEMGP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one (CID 58736676) is 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one is O=C1NCCc2ccc([N+](=O)[O-])c(O)c21.
What is the InChIKey of 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is VUHJZOZDPJEMGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4/c12-8-6(11(14)15)2-1-5-3-4-10-9(13)7(5)8/h1-2,12H,3-4H2,(H,10,13).
What are the key properties of 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one?
8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 208.17 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-7-nitro-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 58736676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).