About (3S)-1,3-dimethylcyclobutene
(3S)-1,3-dimethylcyclobutene (PubChem CID 58737300) has the molecular formula C6H10
and a molecular weight of 82.15 g/mol. Its IUPAC name is (3S)-1,3-dimethylcyclobutene.
Molecular Properties
| Compound Name | (3S)-1,3-dimethylcyclobutene |
| PubChem CID | 58737300 |
| Molecular Formula | C6H10 |
| Molecular Weight | 82.15 g/mol |
| Exact Mass | 82.08 |
| IUPAC Name | (3S)-1,3-dimethylcyclobutene |
| SMILES | CC1=C[C@@H](C)C1 |
| InChI | InChI=1S/C6H10/c1-5-3-6(2)4-5/h3,5H,4H2,1-2H3/t5-/m1/s1 |
| InChIKey | NMEAQEWKOFLHNI-RXMQYKEDSA-N |
| XLogP | 1.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 82.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1,3-dimethylcyclobutene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,3-dimethylcyclobutene?
The IUPAC name of (3S)-1,3-dimethylcyclobutene (CID 58737300) is (3S)-1,3-dimethylcyclobutene.
What is the SMILES notation for (3S)-1,3-dimethylcyclobutene?
The canonical SMILES for (3S)-1,3-dimethylcyclobutene is CC1=C[C@@H](C)C1.
What is the InChIKey of (3S)-1,3-dimethylcyclobutene?
The InChIKey is NMEAQEWKOFLHNI-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10/c1-5-3-6(2)4-5/h3,5H,4H2,1-2H3/t5-/m1/s1.
What are the key properties of (3S)-1,3-dimethylcyclobutene?
(3S)-1,3-dimethylcyclobutene has a molecular weight of 82.15 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,3-dimethylcyclobutene is sourced from PubChem (CID 58737300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).