About ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate
ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate (PubChem CID 58737323) has the molecular formula C17H21ClO5
and a molecular weight of 340.80 g/mol. Its IUPAC name is ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate |
| PubChem CID | 58737323 |
| Molecular Formula | C17H21ClO5 |
| Molecular Weight | 340.80 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)C1(CCCCl)Cc2cc(OC)c(OC)cc2C1=O |
| InChI | InChI=1S/C17H21ClO5/c1-4-23-16(20)17(6-5-7-18)10-11-8-13(21-2)14(22-3)9-12(11)15(17)19/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | NZZMLRHBRIJDCC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate?
The IUPAC name of ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate (CID 58737323) is ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate.
What is the SMILES notation for ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate?
The canonical SMILES for ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate is CCOC(=O)C1(CCCCl)Cc2cc(OC)c(OC)cc2C1=O.
What is the InChIKey of ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate?
The InChIKey is NZZMLRHBRIJDCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClO5/c1-4-23-16(20)17(6-5-7-18)10-11-8-13(21-2)14(22-3)9-12(11)15(17)19/h8-9H,4-7,10H2,1-3H3.
What are the key properties of ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate?
ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate has a molecular weight of 340.80 g/mol, XLogP of 3.01, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-chloropropyl)-5,6-dimethoxy-3-oxo-1H-indene-2-carboxylate is sourced from PubChem (CID 58737323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).