About 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide
4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide (PubChem CID 587377) has the molecular formula C19H10ClF3N2OS2
and a molecular weight of 438.88 g/mol. Its IUPAC name is 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide |
| PubChem CID | 587377 |
| Molecular Formula | C19H10ClF3N2OS2 |
| Molecular Weight | 438.88 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc2c(-c3ccccc3)c(C(F)(F)F)sc2s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H10ClF3N2OS2/c20-12-8-6-11(7-9-12)16(26)25-18-24-14-13(10-4-2-1-3-5-10)15(19(21,22)23)27-17(14)28-18/h1-9H,(H,24,25,26) |
| InChIKey | CKFZQIPXLXXCOP-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.88 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide?
The IUPAC name of 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide (CID 587377) is 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide.
What is the SMILES notation for 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide?
The canonical SMILES for 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide is O=C(Nc1nc2c(-c3ccccc3)c(C(F)(F)F)sc2s1)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide?
The InChIKey is CKFZQIPXLXXCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10ClF3N2OS2/c20-12-8-6-11(7-9-12)16(26)25-18-24-14-13(10-4-2-1-3-5-10)15(19(21,22)23)27-17(14)28-18/h1-9H,(H,24,25,26).
What are the key properties of 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide?
4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide has a molecular weight of 438.88 g/mol, XLogP of 6.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[6-phenyl-5-(trifluoromethyl)thieno[3,2-d][1,3]thiazol-2-yl]benzamide is sourced from PubChem (CID 587377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).