C7H11NO2 — CID 58738334
(3R,4S)-1,3,4-trimethylpyrrolidine-2,5-dione (PubChem CID 58738334) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (3R,4S)-1,3,4-trimethylpyrrolidine-2,5-dione.
| Compound Name | (3R,4S)-1,3,4-trimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58738334 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (3R,4S)-1,3,4-trimethylpyrrolidine-2,5-dione |
| SMILES | C[C@@H]1C(=O)N(C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C7H11NO2/c1-4-5(2)7(10)8(3)6(4)9/h4-5H,1-3H3/t4-,5+ |
| InChIKey | QWAXPPSBSBVTPN-SYDPRGILSA-N |
| XLogP | 0.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|