C12H22NO4 — CID 58738350
CID 58738350 (PubChem CID 58738350) has the molecular formula C12H22NO4 and a molecular weight of 244.31 g/mol.
| Compound Name | CID 58738350 |
|---|---|
| PubChem CID | 58738350 |
| Molecular Formula | C12H22NO4 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | — |
| SMILES | CCC1[CH]C(NC(C)=O)C(COC)OC1CO |
| InChI | InChI=1S/C12H22NO4/c1-4-9-5-10(13-8(2)15)12(7-16-3)17-11(9)6-14/h5,9-12,14H,4,6-7H2,1-3H3,(H,13,15) |
| InChIKey | XVVXOAUJCYNWMO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |