About 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene
5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene (PubChem CID 58738373) has the molecular formula C14H4ClF9O2
and a molecular weight of 410.62 g/mol. Its IUPAC name is 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene.
Molecular Properties
| Compound Name | 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene |
| PubChem CID | 58738373 |
| Molecular Formula | C14H4ClF9O2 |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene |
| SMILES | Fc1cc(OC(F)(F)c2c(F)cc(Cl)cc2F)cc(F)c1OC(F)(F)F |
| InChI | InChI=1S/C14H4ClF9O2/c15-5-1-7(16)11(8(17)2-5)13(20,21)25-6-3-9(18)12(10(19)4-6)26-14(22,23)24/h1-4H |
| InChIKey | DNALMMBUPLTPKK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene?
The IUPAC name of 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene (CID 58738373) is 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene.
What is the SMILES notation for 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene?
The canonical SMILES for 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene is Fc1cc(OC(F)(F)c2c(F)cc(Cl)cc2F)cc(F)c1OC(F)(F)F.
What is the InChIKey of 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene?
The InChIKey is DNALMMBUPLTPKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H4ClF9O2/c15-5-1-7(16)11(8(17)2-5)13(20,21)25-6-3-9(18)12(10(19)4-6)26-14(22,23)24/h1-4H.
What are the key properties of 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene?
5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene has a molecular weight of 410.62 g/mol, XLogP of 5.92, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluorobenzene is sourced from PubChem (CID 58738373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).