C8H20N4S — CID 58738709
4-[2-(dimethylamino)ethyl]-1,5-dimethyl-1,2,4-triazolidine-3-thiol (PubChem CID 58738709) has the molecular formula C8H20N4S and a molecular weight of 204.34 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]-1,5-dimethyl-1,2,4-triazolidine-3-thiol.
| Compound Name | 4-[2-(dimethylamino)ethyl]-1,5-dimethyl-1,2,4-triazolidine-3-thiol |
|---|---|
| PubChem CID | 58738709 |
| Molecular Formula | C8H20N4S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]-1,5-dimethyl-1,2,4-triazolidine-3-thiol |
| SMILES | CC1N(C)NC(S)N1CCN(C)C |
| InChI | InChI=1S/C8H20N4S/c1-7-11(4)9-8(13)12(7)6-5-10(2)3/h7-9,13H,5-6H2,1-4H3 |
| InChIKey | JIBBMWDZWQDWLV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|