About 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate
1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate (PubChem CID 58738746) has the molecular formula C4H9N3S
and a molecular weight of 131.20 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate.
Molecular Properties
| Compound Name | 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate |
| PubChem CID | 58738746 |
| Molecular Formula | C4H9N3S |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate |
| SMILES | CN1N[N+](C)=CC1[S-] |
| InChI | InChI=1S/C4H9N3S/c1-6-3-4(8)7(2)5-6/h3-5H,1-2H3 |
| InChIKey | JMYSUXXVEKOCSX-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate?
The IUPAC name of 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate (CID 58738746) is 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate.
What is the SMILES notation for 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate?
The canonical SMILES for 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate is CN1N[N+](C)=CC1[S-].
What is the InChIKey of 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate?
The InChIKey is JMYSUXXVEKOCSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3S/c1-6-3-4(8)7(2)5-6/h3-5H,1-2H3.
What are the key properties of 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate?
1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate has a molecular weight of 131.20 g/mol, XLogP of -1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2,4-dihydrotriazol-1-ium-4-thiolate is sourced from PubChem (CID 58738746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).