C4H12N4S — CID 58738766
4-amino-1,5-dimethyl-1,2,4-triazolidin-4-ium-3-thiolate (PubChem CID 58738766) has the molecular formula C4H12N4S and a molecular weight of 148.23 g/mol. Its IUPAC name is 4-amino-1,5-dimethyl-1,2,4-triazolidin-4-ium-3-thiolate.
| Compound Name | 4-amino-1,5-dimethyl-1,2,4-triazolidin-4-ium-3-thiolate |
|---|---|
| PubChem CID | 58738766 |
| Molecular Formula | C4H12N4S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 4-amino-1,5-dimethyl-1,2,4-triazolidin-4-ium-3-thiolate |
| SMILES | CC1N(C)NC([S-])[NH+]1N |
| InChI | InChI=1S/C4H12N4S/c1-3-7(2)6-4(9)8(3)5/h3-4,6,9H,5H2,1-2H3 |
| InChIKey | BBXNSTJWMDDHLH-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|