C8H18O4S2 — CID 58738827
3-[2-(3,3-dihydroxypropylsulfanyl)ethylsulfanyl]propane-1,1-diol (PubChem CID 58738827) has the molecular formula C8H18O4S2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-[2-(3,3-dihydroxypropylsulfanyl)ethylsulfanyl]propane-1,1-diol.
| Compound Name | 3-[2-(3,3-dihydroxypropylsulfanyl)ethylsulfanyl]propane-1,1-diol |
|---|---|
| PubChem CID | 58738827 |
| Molecular Formula | C8H18O4S2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-[2-(3,3-dihydroxypropylsulfanyl)ethylsulfanyl]propane-1,1-diol |
| SMILES | OC(O)CCSCCSCCC(O)O |
| InChI | InChI=1S/C8H18O4S2/c9-7(10)1-3-13-5-6-14-4-2-8(11)12/h7-12H,1-6H2 |
| InChIKey | MDKZXTVDKHNACA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|