C13H25NO — CID 58739131
3,4-ditert-butyl-1-methylpyrrolidin-2-one (PubChem CID 58739131) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 3,4-ditert-butyl-1-methylpyrrolidin-2-one.
| Compound Name | 3,4-ditert-butyl-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 58739131 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 3,4-ditert-butyl-1-methylpyrrolidin-2-one |
| SMILES | CN1CC(C(C)(C)C)C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C13H25NO/c1-12(2,3)9-8-14(7)11(15)10(9)13(4,5)6/h9-10H,8H2,1-7H3 |
| InChIKey | COJBJTXRBIRBNS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |