C12H19NO3 — CID 58739346
ethyl (4aS,8aR)-7-oxo-1,3,4,4a,5,6,8,8a-octahydroisoquinoline-2-carboxylate (PubChem CID 58739346) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is ethyl (4aS,8aR)-7-oxo-1,3,4,4a,5,6,8,8a-octahydroisoquinoline-2-carboxylate.
| Compound Name | ethyl (4aS,8aR)-7-oxo-1,3,4,4a,5,6,8,8a-octahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 58739346 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | ethyl (4aS,8aR)-7-oxo-1,3,4,4a,5,6,8,8a-octahydroisoquinoline-2-carboxylate |
| SMILES | CCOC(=O)N1CC[C@@H]2CCC(=O)C[C@H]2C1 |
| InChI | InChI=1S/C12H19NO3/c1-2-16-12(15)13-6-5-9-3-4-11(14)7-10(9)8-13/h9-10H,2-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | UWXKPYMJZCTHJN-UWVGGRQHSA-N |
| XLogP | 1.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |