About 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid
2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid (PubChem CID 58739814) has the molecular formula C21H13FN4O2S
and a molecular weight of 404.43 g/mol. Its IUPAC name is 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid.
Molecular Properties
| Compound Name | 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid |
| PubChem CID | 58739814 |
| Molecular Formula | C21H13FN4O2S |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid |
| SMILES | N#Cc1c(N)nc(SC(C(=O)O)c2ccccc2)c(C#N)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H13FN4O2S/c22-14-8-6-12(7-9-14)17-15(10-23)19(25)26-20(16(17)11-24)29-18(21(27)28)13-4-2-1-3-5-13/h1-9,18H,(H2,25,26)(H,27,28) |
| InChIKey | LPKVQVMWNWUBBK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid?
The IUPAC name of 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid (CID 58739814) is 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid.
What is the SMILES notation for 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid?
The canonical SMILES for 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid is N#Cc1c(N)nc(SC(C(=O)O)c2ccccc2)c(C#N)c1-c1ccc(F)cc1.
What is the InChIKey of 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid?
The InChIKey is LPKVQVMWNWUBBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13FN4O2S/c22-14-8-6-12(7-9-14)17-15(10-23)19(25)26-20(16(17)11-24)29-18(21(27)28)13-4-2-1-3-5-13/h1-9,18H,(H2,25,26)(H,27,28).
What are the key properties of 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid?
2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid has a molecular weight of 404.43 g/mol, XLogP of 4.13, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-amino-3,5-dicyano-4-(4-fluorophenyl)-2-pyridinyl]sulfanyl]-2-phenylacetic acid is sourced from PubChem (CID 58739814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).