C22H13Cl2FN4O2S — CID 58739979
2-amino-6-[2-(2,4-dichloro-5-fluorophenyl)-2-oxoethyl]sulfanyl-4-(4-methoxyphenyl)pyridine-3,5-dicarbonitrile (PubChem CID 58739979) has the molecular formula C22H13Cl2FN4O2S and a molecular weight of 487.34 g/mol. Its IUPAC name is 2-amino-6-[2-(2,4-dichloro-5-fluorophenyl)-2-oxoethyl]sulfanyl-4-(4-methoxyphenyl)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-[2-(2,4-dichloro-5-fluorophenyl)-2-oxoethyl]sulfanyl-4-(4-methoxyphenyl)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 58739979 |
| Molecular Formula | C22H13Cl2FN4O2S |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 2-amino-6-[2-(2,4-dichloro-5-fluorophenyl)-2-oxoethyl]sulfanyl-4-(4-methoxyphenyl)pyridine-3,5-dicarbonitrile |
| SMILES | COc1ccc(-c2c(C#N)c(N)nc(SCC(=O)c3cc(F)c(Cl)cc3Cl)c2C#N)cc1 |
| InChI | InChI=1S/C22H13Cl2FN4O2S/c1-31-12-4-2-11(3-5-12)20-14(8-26)21(28)29-22(15(20)9-27)32-10-19(30)13-6-18(25)17(24)7-16(13)23/h2-7H,10H2,1H3,(H2,28,29) |
| InChIKey | AHMZWOLBAQMSTQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|