C26H27N3O4 — CID 58740807
(E)-3-[4-[(5-acetyl-4-phenyl-1H-imidazol-2-yl)methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 58740807) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (E)-3-[4-[(5-acetyl-4-phenyl-1H-imidazol-2-yl)methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[4-[(5-acetyl-4-phenyl-1H-imidazol-2-yl)methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 58740807 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (E)-3-[4-[(5-acetyl-4-phenyl-1H-imidazol-2-yl)methyl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | CC(=O)c1[nH]c(Cc2ccc(/C=C/C(=O)NOC3CCCCO3)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C26H27N3O4/c1-18(30)25-26(21-7-3-2-4-8-21)28-22(27-25)17-20-12-10-19(11-13-20)14-15-23(31)29-33-24-9-5-6-16-32-24/h2-4,7-8,10-15,24H,5-6,9,16-17H2,1H3,(H,27,28)(H,29,31)/b15-14+ |
| InChIKey | LBAGZPHLNUKBSJ-CCEZHUSRSA-N |
| XLogP | 4.46 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|