About (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran
(3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran (PubChem CID 58740911) has the molecular formula C10H11FO2
and a molecular weight of 182.19 g/mol. Its IUPAC name is (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran |
| PubChem CID | 58740911 |
| Molecular Formula | C10H11FO2 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran |
| SMILES | COC[C@H]1COc2ccc(F)cc21 |
| InChI | InChI=1S/C10H11FO2/c1-12-5-7-6-13-10-3-2-8(11)4-9(7)10/h2-4,7H,5-6H2,1H3/t7-/m0/s1 |
| InChIKey | BXBFQJZUKSMRQW-ZETCQYMHSA-N |
| XLogP | 1.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran?
The IUPAC name of (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran (CID 58740911) is (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran.
What is the SMILES notation for (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran?
The canonical SMILES for (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran is COC[C@H]1COc2ccc(F)cc21.
What is the InChIKey of (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran?
The InChIKey is BXBFQJZUKSMRQW-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H11FO2/c1-12-5-7-6-13-10-3-2-8(11)4-9(7)10/h2-4,7H,5-6H2,1H3/t7-/m0/s1.
What are the key properties of (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran?
(3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran has a molecular weight of 182.19 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 58740911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).