C11H19Cl2NO2 — CID 58741320
2,2-dichloro-1-ethyl-N-(1-methoxypropan-2-yl)-3-methylcyclopropane-1-carboxamide (PubChem CID 58741320) has the molecular formula C11H19Cl2NO2 and a molecular weight of 268.18 g/mol. Its IUPAC name is 2,2-dichloro-1-ethyl-N-(1-methoxypropan-2-yl)-3-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-ethyl-N-(1-methoxypropan-2-yl)-3-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 58741320 |
| Molecular Formula | C11H19Cl2NO2 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2,2-dichloro-1-ethyl-N-(1-methoxypropan-2-yl)-3-methylcyclopropane-1-carboxamide |
| SMILES | CCC1(C(=O)NC(C)COC)C(C)C1(Cl)Cl |
| InChI | InChI=1S/C11H19Cl2NO2/c1-5-10(8(3)11(10,12)13)9(15)14-7(2)6-16-4/h7-8H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | HNHIWHKXKRLSPH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|