C36H40I2O7 — CID 58741526
(23R)-25,36-diiodo-3,6,9,12,15-pentaoxahexacyclo[15.15.7.123,27.134,38.02,29.016,21]hentetraconta-1,17,19,24,26,29,31,34(40),35,37-decaene-40,41-diol (PubChem CID 58741526) has the molecular formula C36H40I2O7 and a molecular weight of 838.52 g/mol. Its IUPAC name is (23R)-25,36-diiodo-3,6,9,12,15-pentaoxahexacyclo[15.15.7.123,27.134,38.02,29.016,21]hentetraconta-1,17,19,24,26,29,31,34(40),35,37-decaene-40,41-diol.
| Compound Name | (23R)-25,36-diiodo-3,6,9,12,15-pentaoxahexacyclo[15.15.7.123,27.134,38.02,29.016,21]hentetraconta-1,17,19,24,26,29,31,34(40),35,37-decaene-40,41-diol |
|---|---|
| PubChem CID | 58741526 |
| Molecular Formula | C36H40I2O7 |
| Molecular Weight | 838.52 g/mol |
| Exact Mass | 838.09 |
| IUPAC Name | (23R)-25,36-diiodo-3,6,9,12,15-pentaoxahexacyclo[15.15.7.123,27.134,38.02,29.016,21]hentetraconta-1,17,19,24,26,29,31,34(40),35,37-decaene-40,41-diol |
| SMILES | Oc1c2cc(I)cc1Cc1cccc3c1OCCOCCOCCOCCOC1C(=CC=CC1C[C@@H]1C=C(I)C=C(C3)C1O)C2 |
| InChI | InChI=1S/C36H40I2O7/c37-31-19-27-15-23-3-1-4-24-16-28-20-32(38)22-30(34(28)40)18-26-6-2-5-25(17-29(21-31)33(27)39)36(26)45-14-12-43-10-8-41-7-9-42-11-13-44-35(23)24/h1-6,19-23,27,33,35,39-40H,7-18H2/t23?,27-,33?,35?/m1/s1 |
| InChIKey | ZJQFZWMCIZWJMM-OYZXXVRDSA-N |
| XLogP | 6.25 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.52 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|