About (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one
(2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one (PubChem CID 58741648) has the molecular formula C13H14F3NO2
and a molecular weight of 273.25 g/mol. Its IUPAC name is (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one.
Molecular Properties
| Compound Name | (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one |
| PubChem CID | 58741648 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one |
| SMILES | CCCCO/N=C(/C(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO2/c1-2-3-9-19-17-12(13(14,15)16)11(18)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3/b17-12- |
| InChIKey | ILTXINFSUQFTQM-ATVHPVEESA-N |
| XLogP | 3.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one?
The IUPAC name of (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one (CID 58741648) is (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one.
What is the SMILES notation for (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one?
The canonical SMILES for (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one is CCCCO/N=C(/C(=O)c1ccccc1)C(F)(F)F.
What is the InChIKey of (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one?
The InChIKey is ILTXINFSUQFTQM-ATVHPVEESA-N. The full InChI is InChI=1S/C13H14F3NO2/c1-2-3-9-19-17-12(13(14,15)16)11(18)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3/b17-12-.
What are the key properties of (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one?
(2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one has a molecular weight of 273.25 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-butoxyimino-3,3,3-trifluoro-1-phenylpropan-1-one is sourced from PubChem (CID 58741648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).