About 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine
6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine (PubChem CID 58742158) has the molecular formula C14H15BrN6OS
and a molecular weight of 395.29 g/mol. Its IUPAC name is 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine |
| PubChem CID | 58742158 |
| Molecular Formula | C14H15BrN6OS |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine |
| SMILES | CSc1c(C)c[n+]([O-])c(Cn2cnc3c(Br)nc(N)nc32)c1C |
| InChI | InChI=1S/C14H15BrN6OS/c1-7-4-21(22)9(8(2)11(7)23-3)5-20-6-17-10-12(15)18-14(16)19-13(10)20/h4,6H,5H2,1-3H3,(H2,16,18,19) |
| InChIKey | GWVWSZCXVOCYLO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine?
The IUPAC name of 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine (CID 58742158) is 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine.
What is the SMILES notation for 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine?
The canonical SMILES for 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine is CSc1c(C)c[n+]([O-])c(Cn2cnc3c(Br)nc(N)nc32)c1C.
What is the InChIKey of 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine?
The InChIKey is GWVWSZCXVOCYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN6OS/c1-7-4-21(22)9(8(2)11(7)23-3)5-20-6-17-10-12(15)18-14(16)19-13(10)20/h4,6H,5H2,1-3H3,(H2,16,18,19).
What are the key properties of 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine?
6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine has a molecular weight of 395.29 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-9-[(3,5-dimethyl-4-methylsulfanyl-1-oxidopyridin-1-ium-2-yl)methyl]purin-2-amine is sourced from PubChem (CID 58742158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).