C21H27NO3S — CID 58742301
(2S,3R,4aR,10aR)-4a-ethyl-3-methyl-2-(4-methyl-1,3-thiazol-2-yl)-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol (PubChem CID 58742301) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is (2S,3R,4aR,10aR)-4a-ethyl-3-methyl-2-(4-methyl-1,3-thiazol-2-yl)-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol.
| Compound Name | (2S,3R,4aR,10aR)-4a-ethyl-3-methyl-2-(4-methyl-1,3-thiazol-2-yl)-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 58742301 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (2S,3R,4aR,10aR)-4a-ethyl-3-methyl-2-(4-methyl-1,3-thiazol-2-yl)-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3nc(C)cs3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C21H27NO3S/c1-4-20-12-19(3,24)21(25,18-22-13(2)11-26-18)10-15(20)6-5-14-9-16(23)7-8-17(14)20/h7-9,11,15,23-25H,4-6,10,12H2,1-3H3/t15-,19-,20-,21-/m1/s1 |
| InChIKey | WCHUPXDELLGMMP-NMSZZDKCSA-N |
| XLogP | 3.80 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |