C29H37N3O4 — CID 58742313
(2R,3R,4aR,10aR)-7-[[5-[(dimethylamino)methyl]-1,2,4-oxadiazol-3-yl]methoxy]-4a-ethyl-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol (PubChem CID 58742313) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is (2R,3R,4aR,10aR)-7-[[5-[(dimethylamino)methyl]-1,2,4-oxadiazol-3-yl]methoxy]-4a-ethyl-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol.
| Compound Name | (2R,3R,4aR,10aR)-7-[[5-[(dimethylamino)methyl]-1,2,4-oxadiazol-3-yl]methoxy]-4a-ethyl-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 58742313 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | (2R,3R,4aR,10aR)-7-[[5-[(dimethylamino)methyl]-1,2,4-oxadiazol-3-yl]methoxy]-4a-ethyl-3-methyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccc3)C[C@H]1CCc1cc(OCc3noc(CN(C)C)n3)ccc12 |
| InChI | InChI=1S/C29H37N3O4/c1-5-28-19-27(2,33)29(34,21-9-7-6-8-10-21)16-22(28)12-11-20-15-23(13-14-24(20)28)35-18-25-30-26(36-31-25)17-32(3)4/h6-10,13-15,22,33-34H,5,11-12,16-19H2,1-4H3/t22-,27-,28-,29-/m1/s1 |
| InChIKey | OMKDSINEHGMELR-KMLOMXCPSA-N |
| XLogP | 4.35 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |