C29H38N4O4 — CID 58742359
(2R,3R,4aR,10aR)-7-[[5-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-3-yl]methoxy]-4a-ethyl-3-methyl-2-pyridin-2-yl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol (PubChem CID 58742359) has the molecular formula C29H38N4O4 and a molecular weight of 506.65 g/mol. Its IUPAC name is (2R,3R,4aR,10aR)-7-[[5-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-3-yl]methoxy]-4a-ethyl-3-methyl-2-pyridin-2-yl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol.
| Compound Name | (2R,3R,4aR,10aR)-7-[[5-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-3-yl]methoxy]-4a-ethyl-3-methyl-2-pyridin-2-yl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 58742359 |
| Molecular Formula | C29H38N4O4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (2R,3R,4aR,10aR)-7-[[5-[2-(dimethylamino)ethyl]-1,2,4-oxadiazol-3-yl]methoxy]-4a-ethyl-3-methyl-2-pyridin-2-yl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3-diol |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccn3)C[C@H]1CCc1cc(OCc3noc(CCN(C)C)n3)ccc12 |
| InChI | InChI=1S/C29H38N4O4/c1-5-28-19-27(2,34)29(35,24-8-6-7-14-30-24)17-21(28)10-9-20-16-22(11-12-23(20)28)36-18-25-31-26(37-32-25)13-15-33(3)4/h6-8,11-12,14,16,21,34-35H,5,9-10,13,15,17-19H2,1-4H3/t21-,27-,28-,29-/m1/s1 |
| InChIKey | ADPHHHKJBDMJBW-MQTVTHGDSA-N |
| XLogP | 3.79 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |