C25H30O5 — CID 58742371
2-[[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]oxy]acetic acid (PubChem CID 58742371) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]oxy]acetic acid.
| Compound Name | 2-[[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 58742371 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl]oxy]acetic acid |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccc3)C[C@H]1CCc1cc(OCC(=O)O)ccc12 |
| InChI | InChI=1S/C25H30O5/c1-3-24-16-23(2,28)25(29,18-7-5-4-6-8-18)14-19(24)10-9-17-13-20(11-12-21(17)24)30-15-22(26)27/h4-8,11-13,19,28-29H,3,9-10,14-16H2,1-2H3,(H,26,27)/t19-,23-,24-,25-/m1/s1 |
| InChIKey | YRXBJXSUKQZTAW-NTMFSWBNSA-N |
| XLogP | 3.79 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |