C22H27NO3 — CID 58742377
(2R,3R,4aR,10aR)-4a-ethyl-3-methyl-2-pyridin-3-yl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol (PubChem CID 58742377) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (2R,3R,4aR,10aR)-4a-ethyl-3-methyl-2-pyridin-3-yl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol.
| Compound Name | (2R,3R,4aR,10aR)-4a-ethyl-3-methyl-2-pyridin-3-yl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 58742377 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (2R,3R,4aR,10aR)-4a-ethyl-3-methyl-2-pyridin-3-yl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3cccnc3)C[C@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C22H27NO3/c1-3-21-14-20(2,25)22(26,17-5-4-10-23-13-17)12-16(21)7-6-15-11-18(24)8-9-19(15)21/h4-5,8-11,13,16,24-26H,3,6-7,12,14H2,1-2H3/t16-,20-,21-,22-/m1/s1 |
| InChIKey | KDUBEHWLJHNXHQ-XUFNMVPLSA-N |
| XLogP | 3.43 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |