C18H25BO7 — CID 58742419
[4-(1,3-dioxolan-2-yl)-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate (PubChem CID 58742419) has the molecular formula C18H25BO7 and a molecular weight of 364.20 g/mol. Its IUPAC name is [4-(1,3-dioxolan-2-yl)-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate.
| Compound Name | [4-(1,3-dioxolan-2-yl)-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 58742419 |
| Molecular Formula | C18H25BO7 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [4-(1,3-dioxolan-2-yl)-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
| SMILES | COc1cc(C2OCCO2)c(B2OC(C)(C)C(C)(C)O2)cc1OC(C)=O |
| InChI | InChI=1S/C18H25BO7/c1-11(20)24-15-10-13(19-25-17(2,3)18(4,5)26-19)12(9-14(15)21-6)16-22-7-8-23-16/h9-10,16H,7-8H2,1-6H3 |
| InChIKey | OAYQAWXMUCMKSV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|