C33H36N4O4 — CID 58742565
4-benzoyl-N-[5-[cyclohexanecarbonyl(methyl)amino]-1-(3-methoxypropyl)benzimidazol-2-yl]benzamide (PubChem CID 58742565) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 4-benzoyl-N-[5-[cyclohexanecarbonyl(methyl)amino]-1-(3-methoxypropyl)benzimidazol-2-yl]benzamide.
| Compound Name | 4-benzoyl-N-[5-[cyclohexanecarbonyl(methyl)amino]-1-(3-methoxypropyl)benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 58742565 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 4-benzoyl-N-[5-[cyclohexanecarbonyl(methyl)amino]-1-(3-methoxypropyl)benzimidazol-2-yl]benzamide |
| SMILES | COCCCn1c(NC(=O)c2ccc(C(=O)c3ccccc3)cc2)nc2cc(N(C)C(=O)C3CCCCC3)ccc21 |
| InChI | InChI=1S/C33H36N4O4/c1-36(32(40)26-12-7-4-8-13-26)27-18-19-29-28(22-27)34-33(37(29)20-9-21-41-2)35-31(39)25-16-14-24(15-17-25)30(38)23-10-5-3-6-11-23/h3,5-6,10-11,14-19,22,26H,4,7-9,12-13,20-21H2,1-2H3,(H,34,35,39) |
| InChIKey | KZQWHRAJPPXYKR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|