C36H24Cl2F4 — CID 58743141
2-chloro-7-[4-(7-chloro-9,9-dimethylfluoren-2-yl)-2,3,5,6-tetrafluorophenyl]-9,9-dimethylfluorene (PubChem CID 58743141) has the molecular formula C36H24Cl2F4 and a molecular weight of 603.49 g/mol. Its IUPAC name is 2-chloro-7-[4-(7-chloro-9,9-dimethylfluoren-2-yl)-2,3,5,6-tetrafluorophenyl]-9,9-dimethylfluorene.
| Compound Name | 2-chloro-7-[4-(7-chloro-9,9-dimethylfluoren-2-yl)-2,3,5,6-tetrafluorophenyl]-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 58743141 |
| Molecular Formula | C36H24Cl2F4 |
| Molecular Weight | 603.49 g/mol |
| Exact Mass | 602.12 |
| IUPAC Name | 2-chloro-7-[4-(7-chloro-9,9-dimethylfluoren-2-yl)-2,3,5,6-tetrafluorophenyl]-9,9-dimethylfluorene |
| SMILES | CC1(C)c2cc(Cl)ccc2-c2ccc(-c3c(F)c(F)c(-c4ccc5c(c4)C(C)(C)c4cc(Cl)ccc4-5)c(F)c3F)cc21 |
| InChI | InChI=1S/C36H24Cl2F4/c1-35(2)25-13-17(5-9-21(25)23-11-7-19(37)15-27(23)35)29-31(39)33(41)30(34(42)32(29)40)18-6-10-22-24-12-8-20(38)16-28(24)36(3,4)26(22)14-18/h5-16H,1-4H3 |
| InChIKey | PSNRDSMJKDONEF-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.49 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|