C11H15F9O — CID 58743433
1,1,1,7,7,7-hexafluoro-2,2,6-trimethyl-4-(trifluoromethyl)heptan-4-ol (PubChem CID 58743433) has the molecular formula C11H15F9O and a molecular weight of 334.22 g/mol. Its IUPAC name is 1,1,1,7,7,7-hexafluoro-2,2,6-trimethyl-4-(trifluoromethyl)heptan-4-ol.
| Compound Name | 1,1,1,7,7,7-hexafluoro-2,2,6-trimethyl-4-(trifluoromethyl)heptan-4-ol |
|---|---|
| PubChem CID | 58743433 |
| Molecular Formula | C11H15F9O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1,1,1,7,7,7-hexafluoro-2,2,6-trimethyl-4-(trifluoromethyl)heptan-4-ol |
| SMILES | CC(CC(O)(CC(C)(C)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F9O/c1-6(9(12,13)14)4-8(21,11(18,19)20)5-7(2,3)10(15,16)17/h6,21H,4-5H2,1-3H3 |
| InChIKey | MBXXDVGWVPFYIV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |