C20H12F24O2 — CID 58743445
5-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,2,2,6,6,7,7,7-decafluoro-3,5-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)heptan-3-ol (PubChem CID 58743445) has the molecular formula C20H12F24O2 and a molecular weight of 740.27 g/mol. Its IUPAC name is 5-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,2,2,6,6,7,7,7-decafluoro-3,5-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)heptan-3-ol.
| Compound Name | 5-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,2,2,6,6,7,7,7-decafluoro-3,5-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)heptan-3-ol |
|---|---|
| PubChem CID | 58743445 |
| Molecular Formula | C20H12F24O2 |
| Molecular Weight | 740.27 g/mol |
| Exact Mass | 740.05 |
| IUPAC Name | 5-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,2,2,6,6,7,7,7-decafluoro-3,5-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)heptan-3-ol |
| SMILES | OC(CC(OC1CC2C=CC1C2)(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H12F24O2/c21-11(15(27,28)29,16(30,31)32)9(45,13(23,24)19(39,40)41)5-10(14(25,26)20(42,43)44,12(22,17(33,34)35)18(36,37)38)46-8-4-6-1-2-7(8)3-6/h1-2,6-8,45H,3-5H2 |
| InChIKey | WQQRYOAALFNLPR-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.27 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|