C20H22F12O4 — CID 58743479
[5-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,6,6,6-hexafluoro-2,5-bis(trifluoromethyl)hexan-2-yl] tert-butyl carbonate (PubChem CID 58743479) has the molecular formula C20H22F12O4 and a molecular weight of 554.37 g/mol. Its IUPAC name is [5-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,6,6,6-hexafluoro-2,5-bis(trifluoromethyl)hexan-2-yl] tert-butyl carbonate.
| Compound Name | [5-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,6,6,6-hexafluoro-2,5-bis(trifluoromethyl)hexan-2-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 58743479 |
| Molecular Formula | C20H22F12O4 |
| Molecular Weight | 554.37 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | [5-(2-bicyclo[2.2.1]hept-5-enyloxy)-1,1,1,6,6,6-hexafluoro-2,5-bis(trifluoromethyl)hexan-2-yl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC(CCC(OC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H22F12O4/c1-14(2,3)35-13(33)36-16(19(27,28)29,20(30,31)32)7-6-15(17(21,22)23,18(24,25)26)34-12-9-10-4-5-11(12)8-10/h4-5,10-12H,6-9H2,1-3H3 |
| InChIKey | GQWVTQBGPVWVES-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.37 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|