C24H23F2N5O3S — CID 58743895
(1S,3S,4S)-N-(6,8-difluoroquinolin-4-yl)-3-hydroxy-4-[(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]cyclohexane-1-carboxamide (PubChem CID 58743895) has the molecular formula C24H23F2N5O3S and a molecular weight of 499.54 g/mol. Its IUPAC name is (1S,3S,4S)-N-(6,8-difluoroquinolin-4-yl)-3-hydroxy-4-[(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3S,4S)-N-(6,8-difluoroquinolin-4-yl)-3-hydroxy-4-[(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58743895 |
| Molecular Formula | C24H23F2N5O3S |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | (1S,3S,4S)-N-(6,8-difluoroquinolin-4-yl)-3-hydroxy-4-[(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]cyclohexane-1-carboxamide |
| SMILES | O=C1CSc2ccc(CN[C@H]3CC[C@H](C(=O)Nc4ccnc5c(F)cc(F)cc45)C[C@@H]3O)nc2N1 |
| InChI | InChI=1S/C24H23F2N5O3S/c25-13-8-15-17(5-6-27-22(15)16(26)9-13)30-24(34)12-1-3-18(19(32)7-12)28-10-14-2-4-20-23(29-14)31-21(33)11-35-20/h2,4-6,8-9,12,18-19,28,32H,1,3,7,10-11H2,(H,27,30,34)(H,29,31,33)/t12-,18-,19-/m0/s1 |
| InChIKey | JRCHTIOVCDZDOL-NXXSPTCGSA-N |
| XLogP | 3.21 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |