C28H24FN5O3 — CID 58744015
15-fluoro-14-(3-imidazol-1-ylpropylamino)-N,N-dimethyl-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide (PubChem CID 58744015) has the molecular formula C28H24FN5O3 and a molecular weight of 497.53 g/mol. Its IUPAC name is 15-fluoro-14-(3-imidazol-1-ylpropylamino)-N,N-dimethyl-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide.
| Compound Name | 15-fluoro-14-(3-imidazol-1-ylpropylamino)-N,N-dimethyl-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide |
|---|---|
| PubChem CID | 58744015 |
| Molecular Formula | C28H24FN5O3 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 15-fluoro-14-(3-imidazol-1-ylpropylamino)-N,N-dimethyl-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide |
| SMILES | CN(C)C(=O)c1cn2c3c(c(NCCCn4ccnc4)c(F)cc3c1=O)Oc1cc3ccccc3cc1-2 |
| InChI | InChI=1S/C28H24FN5O3/c1-32(2)28(36)20-15-34-22-12-17-6-3-4-7-18(17)13-23(22)37-27-24(21(29)14-19(25(27)34)26(20)35)31-8-5-10-33-11-9-30-16-33/h3-4,6-7,9,11-16,31H,5,8,10H2,1-2H3 |
| InChIKey | XRPKGKIIUQCJKT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|