C30H33N5O3 — CID 58744169
14-(3-aminopyrrolidin-1-yl)-N-[4-(dimethylamino)butyl]-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13,15,17(21),19-nonaene-19-carboxamide (PubChem CID 58744169) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is 14-(3-aminopyrrolidin-1-yl)-N-[4-(dimethylamino)butyl]-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13,15,17(21),19-nonaene-19-carboxamide.
| Compound Name | 14-(3-aminopyrrolidin-1-yl)-N-[4-(dimethylamino)butyl]-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13,15,17(21),19-nonaene-19-carboxamide |
|---|---|
| PubChem CID | 58744169 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 14-(3-aminopyrrolidin-1-yl)-N-[4-(dimethylamino)butyl]-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13,15,17(21),19-nonaene-19-carboxamide |
| SMILES | CN(C)CCCCNC(=O)c1cn2c3c(c(N4CCC(N)C4)ccc3c1=O)Oc1cc3ccccc3cc1-2 |
| InChI | InChI=1S/C30H33N5O3/c1-33(2)13-6-5-12-32-30(37)23-18-35-25-15-19-7-3-4-8-20(19)16-26(25)38-29-24(34-14-11-21(31)17-34)10-9-22(27(29)35)28(23)36/h3-4,7-10,15-16,18,21H,5-6,11-14,17,31H2,1-2H3,(H,32,37) |
| InChIKey | RSFCFJFHHYSOBE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|