C20H9FN4O4 — CID 58744935
14-azido-15-fluoro-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-2(11),3,5,7,9,13(21),14,16,19-nonaene-19-carboxylic acid (PubChem CID 58744935) has the molecular formula C20H9FN4O4 and a molecular weight of 388.31 g/mol. Its IUPAC name is 14-azido-15-fluoro-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-2(11),3,5,7,9,13(21),14,16,19-nonaene-19-carboxylic acid.
| Compound Name | 14-azido-15-fluoro-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-2(11),3,5,7,9,13(21),14,16,19-nonaene-19-carboxylic acid |
|---|---|
| PubChem CID | 58744935 |
| Molecular Formula | C20H9FN4O4 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 14-azido-15-fluoro-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-2(11),3,5,7,9,13(21),14,16,19-nonaene-19-carboxylic acid |
| SMILES | [N-]=[N+]=Nc1c(F)cc2c(=O)c(C(=O)O)cn3c2c1Oc1c-3ccc2ccccc12 |
| InChI | InChI=1S/C20H9FN4O4/c21-13-7-11-16-19(15(13)23-24-22)29-18-10-4-2-1-3-9(10)5-6-14(18)25(16)8-12(17(11)26)20(27)28/h1-8H,(H,27,28) |
| InChIKey | VCWGLIDFJOGRRU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|