C28H27FN4O4 — CID 58745044
14-[2-(ethylamino)ethylamino]-15-fluoro-19-(morpholine-4-carbonyl)-12-oxa-1-azapentacyclo[11.7.1.02,11.03,8.017,21]henicosa-2(11),3,5,7,9,13(21),14,16,19-nonaen-18-one (PubChem CID 58745044) has the molecular formula C28H27FN4O4 and a molecular weight of 502.55 g/mol. Its IUPAC name is 14-[2-(ethylamino)ethylamino]-15-fluoro-19-(morpholine-4-carbonyl)-12-oxa-1-azapentacyclo[11.7.1.02,11.03,8.017,21]henicosa-2(11),3,5,7,9,13(21),14,16,19-nonaen-18-one.
| Compound Name | 14-[2-(ethylamino)ethylamino]-15-fluoro-19-(morpholine-4-carbonyl)-12-oxa-1-azapentacyclo[11.7.1.02,11.03,8.017,21]henicosa-2(11),3,5,7,9,13(21),14,16,19-nonaen-18-one |
|---|---|
| PubChem CID | 58745044 |
| Molecular Formula | C28H27FN4O4 |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 14-[2-(ethylamino)ethylamino]-15-fluoro-19-(morpholine-4-carbonyl)-12-oxa-1-azapentacyclo[11.7.1.02,11.03,8.017,21]henicosa-2(11),3,5,7,9,13(21),14,16,19-nonaen-18-one |
| SMILES | CCNCCNc1c(F)cc2c(=O)c(C(=O)N3CCOCC3)cn3c2c1Oc1ccc2ccccc2c1-3 |
| InChI | InChI=1S/C28H27FN4O4/c1-2-30-9-10-31-23-21(29)15-19-25-27(23)37-22-8-7-17-5-3-4-6-18(17)24(22)33(25)16-20(26(19)34)28(35)32-11-13-36-14-12-32/h3-8,15-16,30-31H,2,9-14H2,1H3 |
| InChIKey | DJPJHLTZWUVRGX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|