About ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium
ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium (PubChem CID 58745283) has the molecular formula C18H11F2NO3Y-2
and a molecular weight of 416.19 g/mol. Its IUPAC name is ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium.
Molecular Properties
| Compound Name | ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium |
| PubChem CID | 58745283 |
| Molecular Formula | C18H11F2NO3Y-2 |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium |
| SMILES | CCOC(=O)c1cn(-c2[c-]cccc2)c2[c-]c(F)c(F)cc2c1=O.[Y] |
| InChI | InChI=1S/C18H11F2NO3.Y/c1-2-24-18(23)13-10-21(11-6-4-3-5-7-11)16-9-15(20)14(19)8-12(16)17(13)22;/h3-6,8,10H,2H2,1H3;/q-2; |
| InChIKey | VXQKWYHVNFSNIW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium?
The IUPAC name of ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium (CID 58745283) is ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium.
What is the SMILES notation for ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium?
The canonical SMILES for ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium is CCOC(=O)c1cn(-c2[c-]cccc2)c2[c-]c(F)c(F)cc2c1=O.[Y].
What is the InChIKey of ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium?
The InChIKey is VXQKWYHVNFSNIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F2NO3.Y/c1-2-24-18(23)13-10-21(11-6-4-3-5-7-11)16-9-15(20)14(19)8-12(16)17(13)22;/h3-6,8,10H,2H2,1H3;/q-2;.
What are the key properties of ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium?
ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium has a molecular weight of 416.19 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6,7-difluoro-4-oxo-1-phenyl-8H-quinolin-8-ide-3-carboxylate;yttrium is sourced from PubChem (CID 58745283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).