C12H20N2O4 — CID 58745484
tert-butyl (4aR,8aR)-2-oxo-1,4a,5,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazine-6-carboxylate (PubChem CID 58745484) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is tert-butyl (4aR,8aR)-2-oxo-1,4a,5,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazine-6-carboxylate.
| Compound Name | tert-butyl (4aR,8aR)-2-oxo-1,4a,5,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazine-6-carboxylate |
|---|---|
| PubChem CID | 58745484 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | tert-butyl (4aR,8aR)-2-oxo-1,4a,5,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2NC(=O)CO[C@@H]2C1 |
| InChI | InChI=1S/C12H20N2O4/c1-12(2,3)18-11(16)14-5-4-8-9(6-14)17-7-10(15)13-8/h8-9H,4-7H2,1-3H3,(H,13,15)/t8-,9-/m1/s1 |
| InChIKey | ADUCRLGBIFPAKD-RKDXNWHRSA-N |
| XLogP | 0.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |