C35H37N5O4 — CID 58745693
(E)-3-[4-[[(3S)-3-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 58745693) has the molecular formula C35H37N5O4 and a molecular weight of 591.71 g/mol. Its IUPAC name is (E)-3-[4-[[(3S)-3-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[(3S)-3-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58745693 |
| Molecular Formula | C35H37N5O4 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | (E)-3-[4-[[(3S)-3-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN1CC[C@@](NC(=O)c2ccc3c(C4CCCC4)c(-c4ccccn4)n(C)c3c2)(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)C1 |
| InChI | InChI=1S/C35H37N5O4/c1-39-20-18-35(22-39,34(44)37-26-14-10-23(11-15-26)12-17-30(41)42)38-33(43)25-13-16-27-29(21-25)40(2)32(28-9-5-6-19-36-28)31(27)24-7-3-4-8-24/h5-6,9-17,19,21,24H,3-4,7-8,18,20,22H2,1-2H3,(H,37,44)(H,38,43)(H,41,42)/b17-12+/t35-/m0/s1 |
| InChIKey | HKEIFAYRXLUISG-FXIAJICWSA-N |
| XLogP | 5.44 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|