C18H17ClF3NO4 — CID 58745835
(3aS,5R,7aR)-2-[4-chloro-2-methyl-3-(trifluoromethyl)phenyl]-5-hydroxy-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 58745835) has the molecular formula C18H17ClF3NO4 and a molecular weight of 403.78 g/mol. Its IUPAC name is (3aS,5R,7aR)-2-[4-chloro-2-methyl-3-(trifluoromethyl)phenyl]-5-hydroxy-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,5R,7aR)-2-[4-chloro-2-methyl-3-(trifluoromethyl)phenyl]-5-hydroxy-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 58745835 |
| Molecular Formula | C18H17ClF3NO4 |
| Molecular Weight | 403.78 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (3aS,5R,7aR)-2-[4-chloro-2-methyl-3-(trifluoromethyl)phenyl]-5-hydroxy-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | Cc1c(N2C(=O)[C@@H]3[C@H](C2=O)C2(C)OC3(C)C[C@H]2O)ccc(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C18H17ClF3NO4/c1-7-9(5-4-8(19)11(7)18(20,21)22)23-14(25)12-13(15(23)26)17(3)10(24)6-16(12,2)27-17/h4-5,10,12-13,24H,6H2,1-3H3/t10-,12+,13-,16?,17?/m1/s1 |
| InChIKey | RYPQCFVVEHAEJA-IULKWVTASA-N |
| XLogP | 3.09 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|