C25H29F3N2O4Si — CID 58745839
(3aR,7aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 58745839) has the molecular formula C25H29F3N2O4Si and a molecular weight of 506.60 g/mol. Its IUPAC name is (3aR,7aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 58745839 |
| Molecular Formula | C25H29F3N2O4Si |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | (3aR,7aS)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)[C@@H]3[C@H](C2=O)C2(C)C=C(CO[Si](C)(C)C(C)(C)C)C3(C)O2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H29F3N2O4Si/c1-22(2,3)35(7,8)33-13-14-12-23(4)18-19(24(14,5)34-23)21(32)30(20(18)31)15-9-10-17(29-6)16(11-15)25(26,27)28/h9-12,18-19H,13H2,1-5,7-8H3/t18-,19+,23?,24?/m1/s1 |
| InChIKey | CUPRDDPSAKLYGR-AQUVGYMESA-N |
| XLogP | 5.87 |
| TPSA | 60.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|