C32H22F5N3O5 — CID 58745867
N-[(3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-4-fluoro-N-(4-fluorobenzoyl)benzamide (PubChem CID 58745867) has the molecular formula C32H22F5N3O5 and a molecular weight of 623.53 g/mol. Its IUPAC name is N-[(3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-4-fluoro-N-(4-fluorobenzoyl)benzamide.
| Compound Name | N-[(3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-4-fluoro-N-(4-fluorobenzoyl)benzamide |
|---|---|
| PubChem CID | 58745867 |
| Molecular Formula | C32H22F5N3O5 |
| Molecular Weight | 623.53 g/mol |
| Exact Mass | 623.15 |
| IUPAC Name | N-[(3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-4-fluoro-N-(4-fluorobenzoyl)benzamide |
| SMILES | CC12C[C@@H](N(C(=O)c3ccc(F)cc3)C(=O)c3ccc(F)cc3)C(C)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C32H22F5N3O5/c1-30-14-23(40(26(41)16-3-8-19(33)9-4-16)27(42)17-5-10-20(34)11-6-17)31(2,45-30)25-24(30)28(43)39(29(25)44)21-12-7-18(15-38)22(13-21)32(35,36)37/h3-13,23-25H,14H2,1-2H3/t23-,24-,25+,30?,31?/m1/s1 |
| InChIKey | PUSRONFRLVYGEI-HBYIFTGOSA-N |
| XLogP | 5.26 |
| TPSA | 107.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|