C24H30N4O5SSi — CID 58745955
(3aS,5R,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-2-(7-isocyano-2,1,3-benzothiadiazol-4-yl)-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 58745955) has the molecular formula C24H30N4O5SSi and a molecular weight of 514.68 g/mol. Its IUPAC name is (3aS,5R,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-2-(7-isocyano-2,1,3-benzothiadiazol-4-yl)-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,5R,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-2-(7-isocyano-2,1,3-benzothiadiazol-4-yl)-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 58745955 |
| Molecular Formula | C24H30N4O5SSi |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | (3aS,5R,7aR)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-hydroxy-2-(7-isocyano-2,1,3-benzothiadiazol-4-yl)-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)[C@@H]3[C@H](C2=O)C2(C)OC3(CCO[Si](C)(C)C(C)(C)C)C[C@H]2O)c2nsnc12 |
| InChI | InChI=1S/C24H30N4O5SSi/c1-22(2,3)35(6,7)32-11-10-24-12-15(29)23(4,33-24)16-17(24)21(31)28(20(16)30)14-9-8-13(25-5)18-19(14)27-34-26-18/h8-9,15-17,29H,10-12H2,1-4,6-7H3/t15-,16-,17+,23?,24?/m1/s1 |
| InChIKey | LWJVLXGSOQVIGU-RPOUUZPESA-N |
| XLogP | 4.05 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|