C18H15F3N2O4 — CID 58745992
4-[(3aR,7aS)-7-(2-hydroxyethyl)-1,3-dioxo-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 58745992) has the molecular formula C18H15F3N2O4 and a molecular weight of 380.32 g/mol. Its IUPAC name is 4-[(3aR,7aS)-7-(2-hydroxyethyl)-1,3-dioxo-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,7aS)-7-(2-hydroxyethyl)-1,3-dioxo-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58745992 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 4-[(3aR,7aS)-7-(2-hydroxyethyl)-1,3-dioxo-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@H]3C4CCC(CCO)(O4)[C@H]3C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C18H15F3N2O4/c19-18(20,21)11-7-10(2-1-9(11)8-22)23-15(25)13-12-3-4-17(27-12,5-6-24)14(13)16(23)26/h1-2,7,12-14,24H,3-6H2/t12?,13-,14+,17?/m0/s1 |
| InChIKey | ODLVGNBUIYLGBZ-YRTQGLMCSA-N |
| XLogP | 2.00 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|