C17H17N3O4 — CID 58746038
(3aR,5S,7aS)-5-hydroxy-2-(5-isocyano-4-methyl-2-pyridinyl)-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 58746038) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is (3aR,5S,7aS)-5-hydroxy-2-(5-isocyano-4-methyl-2-pyridinyl)-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,5S,7aS)-5-hydroxy-2-(5-isocyano-4-methyl-2-pyridinyl)-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 58746038 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (3aR,5S,7aS)-5-hydroxy-2-(5-isocyano-4-methyl-2-pyridinyl)-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | [C-]#[N+]c1cnc(N2C(=O)[C@@H]3[C@H](C2=O)C2(C)C[C@H](O)C3(C)O2)cc1C |
| InChI | InChI=1S/C17H17N3O4/c1-8-5-11(19-7-9(8)18-4)20-14(22)12-13(15(20)23)17(3)10(21)6-16(12,2)24-17/h5,7,10,12-13,21H,6H2,1-3H3/t10-,12+,13-,16?,17?/m0/s1 |
| InChIKey | MDBKFNRTHFLOAA-MXIPMBNRSA-N |
| XLogP | 1.36 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|